D-Galactose | |
---|---|
Identifiers | |
CAS number | |
PubChem | |
KEGG | D04291 |
MeSH | |
ChEBI | CHEBI:28061 |
SMILES | O[C@H]1[C@@H](O)[C@H](O[C@H](O)[C@@H]1O)CO |
Properties | |
Molecular formula | C6H12O6 |
Molar mass | 180.12 g mol-1 |
Appearance | White solid |
Odor | Odorless |
Density | 1.5 g/cm3 |
Melting point | 168-170 °C, 271 K, -106 °F |
Solubility in water | 650 g/L (20 °C) |
-103.00·10−6 cm3/mol | |
Pharmacology | |
ATC code | |
Hazards | |
NFPA 704 | |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
Galactose (from the Greek stem γάλακτ– galakt–, "milk") is a sugar. It has almost the same chemical structure as glucose.
Large amounts of pure galactose do not exist in nature. Instead, galactose is usually found with glucose in lactose, a sugar found in milk and other milk products. After lactose is digested and absorbed, galactose arrives in the liver. There it is changed into either glucose or glycogen. view more...