|
| D-Galactose | |
|---|---|
 | |
 |  |
| Identifiers | |
| CAS number | |
| PubChem | |
| KEGG | D04291 |
| MeSH | |
| ChEBI | CHEBI:28061 |
| SMILES | O[C@H]1[C@@H](O)[C@H](O[C@H](O)[C@@H]1O)CO |
| Properties | |
| Molecular formula | C6H12O6 |
| Molar mass | 180.12 g mol-1 |
| Appearance | White solid |
| Odor | Odorless |
| Density | 1.5 g/cm3 |
| Melting point | 168-170 °C, 271 K, -106 °F |
| Solubility in water | 650 g/L (20 °C) |
| -103.00·10−6 cm3/mol | |
| Pharmacology | |
| ATC code | |
| Hazards | |
| NFPA 704 |
0 1 0 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Galactose (from the Greek stem γάλακτ– galakt–, "milk") is a sugar. It has almost the same chemical structure as glucose.
Large amounts of pure galactose do not exist in nature. Instead, galactose is usually found with glucose in lactose, a sugar found in milk and other milk products. After lactose is digested and absorbed, galactose arrives in the liver. There it is changed into either glucose or glycogen. view more...
 |
|
